cas: 15629-92-2 — see every product listed under this CAS number, including other names
1,3-Bis(diphenylphosphino)propanedichloronickel II, 95% (CAS 15629-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044623-1G |
| cas | 15629-92-2 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 825.77 Pln | |
| Fluorochem | 1kg | 1585.92 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| transportryczalt.1 | 50 |
| category | Odczynniki chemiczne |
Dichloronickel;3-diphenylphosphanylpropyl(diphenyl)phosphane (CAS 15629-92-2) is a chemical compound with the molecular formula C27H26Cl2NiP2 and a molecular weight of 542.0 g/mol. IUPAC name: dichloronickel;3-diphenylphosphanylpropyl(diphenyl)phosphane. InChIKey: ZBQUMMFUJLOTQC-UHFFFAOYSA-L.
| Molecular formula | C27H26Cl2NiP2 |
|---|---|
| Molecular weight | 542.0 g/mol |
| IUPAC name | dichloronickel;3-diphenylphosphanylpropyl(diphenyl)phosphane |
| InChIKey | ZBQUMMFUJLOTQC-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Ni]Cl |
Computed by PubChem (NCBI)