cas: 402519-26-0 — see every product listed under this CAS number, including other names
1,3-Diallylbenzimidazolium bromide, 95-<97% (CAS 402519-26-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6759-95-97-10g |
| cas | 402519-26-0 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 12417.24 Pln | |
| Hoffman Fine Chemicals | 25g | 24526.48 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1,3-bis(prop-2-enyl)benzimidazol-3-ium bromide (CAS 402519-26-0) is a chemical compound with the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. IUPAC name: 1,3-bis(prop-2-enyl)benzimidazol-3-ium bromide. InChIKey: HXTHFTVQGOBVKV-UHFFFAOYSA-M.
| Molecular formula | C13H15BrN2 |
|---|---|
| Molecular weight | 279.18 g/mol |
| IUPAC name | 1,3-bis(prop-2-enyl)benzimidazol-3-ium bromide |
| InChIKey | HXTHFTVQGOBVKV-UHFFFAOYSA-M |
| SMILES | C=CCN1C=[N+](C2=CC=CC=C21)CC=C.[Br-] |
Computed by PubChem (NCBI)