cas: 1245635-36-2 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-(methoxymethoxy)-5-methylbenzene (CAS 1245635-36-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631233-1G |
| cas | 1245635-36-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3481.08 Pln | |
| Fluorochem | 5g | 10296.39 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dibromo-2-(methoxymethoxy)-5-methylbenzene (CAS 1245635-36-2) is a chemical compound with the molecular formula C9H10Br2O2 and a molecular weight of 309.98 g/mol. IUPAC name: 1,3-dibromo-2-(methoxymethoxy)-5-methylbenzene. InChIKey: SGEMXXQSQUWKGX-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O2 |
|---|---|
| Molecular weight | 309.98 g/mol |
| IUPAC name | 1,3-dibromo-2-(methoxymethoxy)-5-methylbenzene |
| InChIKey | SGEMXXQSQUWKGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCOC)Br |
Computed by PubChem (NCBI)