cas: 2379321-83-0 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-ethoxy-5-isopropylbenzene (CAS 2379321-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630107-1G |
| cas | 2379321-83-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2257.56 Pln | |
| Fluorochem | 5g | 6631.02 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dibromo-2-ethoxy-5-propan-2-ylbenzene (CAS 2379321-83-0) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 1,3-dibromo-2-ethoxy-5-propan-2-ylbenzene. InChIKey: GPYCNHRPWCEBJP-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 1,3-dibromo-2-ethoxy-5-propan-2-ylbenzene |
| InChIKey | GPYCNHRPWCEBJP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Br)C(C)C)Br |
Computed by PubChem (NCBI)