cas: 2121515-32-8 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-pentoxybenzene (CAS 2121515-32-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631329-5G |
| cas | 2121515-32-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 2996.88 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dibromo-5-pentoxybenzene (CAS 2121515-32-8) is a chemical compound with the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. IUPAC name: 1,3-dibromo-5-pentoxybenzene. InChIKey: KEOSYTVJONKJRL-UHFFFAOYSA-N.
| Molecular formula | C11H14Br2O |
|---|---|
| Molecular weight | 322.04 g/mol |
| IUPAC name | 1,3-dibromo-5-pentoxybenzene |
| InChIKey | KEOSYTVJONKJRL-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)