cas: 1379325-36-6 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-(chloromethyl)-4-methylbenzene 95% (CAS 1379325-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A303298-100mg |
| cas | 1379325-36-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1349.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A303298 |
1,3-dichloro-2-(chloromethyl)-4-methylbenzene (CAS 1379325-36-6) is a chemical compound with the molecular formula C8H7Cl3 and a molecular weight of 209.5 g/mol. IUPAC name: 1,3-dichloro-2-(chloromethyl)-4-methylbenzene. InChIKey: YFYOOPHGLJWGNL-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3 |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 1,3-dichloro-2-(chloromethyl)-4-methylbenzene |
| InChIKey | YFYOOPHGLJWGNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)CCl)Cl |
Computed by PubChem (NCBI)