1,3-Diisopropyl-1H-imidazol-3-ium chloride, 97%
cas: 139143-09-2 — see every product listed under this CAS number, including other names
1,3-Diisopropyl-1H-imidazol-3-ium chloride, 97% (CAS 139143-09-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A937356-1g |
| cas | 139143-09-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 859.88 Pln | |
| Ambeed | 100g | 3218.38 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 500mg | 88.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 25g | 645.20 Pln | |
| Chemat | 100g | 2282.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 353.23 Pln | |
| BLDpharm | 25g | 919.70 Pln | |
| BLDpharm | 100g | 3463.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,3-di(propan-2-yl)imidazol-1-ium chloride (CAS 139143-09-2) is a chemical compound with the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. IUPAC name: 1,3-di(propan-2-yl)imidazol-1-ium chloride. InChIKey: DOFXKPAOJLLPII-UHFFFAOYSA-M.
| Molecular formula | C9H17ClN2 |
|---|---|
| Molecular weight | 188.70 g/mol |
| IUPAC name | 1,3-di(propan-2-yl)imidazol-1-ium chloride |
| InChIKey | DOFXKPAOJLLPII-UHFFFAOYSA-M |
| SMILES | CC(C)N1C=C[N+](=C1)C(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
1,3-Diisopropylimidazolium chloride, 1,3-Diisopropyl-1H-imidazol-3-ium chloride, N,N'-(Isopropyl)imidazolium chloride, BISIISOPROPYLPHENYLIMIDAZOLIUMCHLORIDE, 1,3-di(propan-2-yl)imidazol-1-ium;chloride, 1,3-di(propan, DIIC, [BzMIm]SOM, 1,3-bis(propan-2-yl)-1H-imidazol-3-ium chloride, DOFXKPAOJLLPII-UHFFFAOYSA-M
