cas: 1240529-56-9 — see every product listed under this CAS number, including other names
1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido(2,3-d)pyrimidine-6-sulfonyl chloride, 97% (CAS 1240529-56-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A610344-5g |
| cas | 1240529-56-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11683.84 Pln | |
| AmBeed | 1g | 6840.40 Pln | |
| AmBeed | 10g | 17282.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride (CAS 1240529-56-9) is a chemical compound with the molecular formula C9H8ClN3O4S and a molecular weight of 289.70 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride. InChIKey: OHOWJILXMPMPGH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O4S |
|---|---|
| Molecular weight | 289.70 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride |
| InChIKey | OHOWJILXMPMPGH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)S(=O)(=O)Cl)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)