cas: 124788-36-9 — see every product listed under this CAS number, including other names
1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride, 96%, 96% (CAS 124788-36-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111MR6-250mg |
| cas | 124788-36-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3011.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonyl chloride (CAS 124788-36-9) is a chemical compound with the molecular formula C6H7ClN2O4S and a molecular weight of 238.65 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonyl chloride. InChIKey: SBIHCODLIXCTKF-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O4S |
|---|---|
| Molecular weight | 238.65 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonyl chloride |
| InChIKey | SBIHCODLIXCTKF-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)N(C1=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)