1,3-di-tert-Butyl-5-iodobenzene, 96%
cas: 37055-53-1 — see every product listed under this CAS number, including other names
1,3-di-tert-Butyl-5-iodobenzene, 96% (CAS 37055-53-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 50g, 100g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F607731-250MG |
| cas | 37055-53-1 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Fluorochem | 25g | 2080.54 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 558.80 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1994.00 Pln | |
| Chemat | 100g | 2267.60 Pln | |
| Chemat | 250g | 4485.20 Pln | |
| Chemat | 500g | 6768.00 Pln |
properties
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1,3-ditert-butyl-5-iodobenzene (CAS 37055-53-1) is a chemical compound with the molecular formula C14H21I and a molecular weight of 316.22 g/mol. IUPAC name: 1,3-ditert-butyl-5-iodobenzene. InChIKey: WHNJNYKUXPHIOO-UHFFFAOYSA-N.
| Molecular formula | C14H21I |
|---|---|
| Molecular weight | 316.22 g/mol |
| IUPAC name | 1,3-ditert-butyl-5-iodobenzene |
| InChIKey | WHNJNYKUXPHIOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)I)C(C)(C)C |
Computed by PubChem (NCBI)