1,4-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene, 98%
cas: 929103-36-6 — see every product listed under this CAS number, including other names
1,4-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene, 98% (CAS 929103-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1186626-100mg |
| cas | 929103-36-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 3902.56 Pln | |
| Ambeed | 10g | 6973.06 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2339.60 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 464.31 Pln | |
| BLDpharm | 1g | 1130.74 Pln | |
| BLDpharm | 5g | 3824.23 Pln | |
| BLDpharm | 10g | 6834.28 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3647.69 Pln | |
| Fluorochem | 10g | 6386.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]-1,3,2-dioxaborolane (CAS 929103-36-6) is a chemical compound with the molecular formula C22H30B2O4 and a molecular weight of 380.1 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]-1,3,2-dioxaborolane. InChIKey: ZQPFIGFAGVSNNZ-UHFFFAOYSA-N.
| Molecular formula | C22H30B2O4 |
|---|---|
| Molecular weight | 380.1 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]-1,3,2-dioxaborolane |
| InChIKey | ZQPFIGFAGVSNNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
1,4-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene, 1,4-Naphthalenediboronic acid bis(pinacol) ester, 2,2'-(1,4-Naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane], ZQPFIGFAGVSNNZ-UHFFFAOYSA-N, 1,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolanyl)-naphthalene, 1,4-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)naphthalene, Naphthalene-1,4-diyldi(boronic Acid Pinacol Ester), 1,3,2-Dioxaborolane, 2,2'-(1,4-naphthalenediyl)bis[4,4,5,5-tetramethyl-