cas: 13280-61-0 — see every product listed under this CAS number, including other names
1,4-Bis(2-methylstyryl)benzene (CAS 13280-61-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033718-1G |
| cas | 13280-61-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 409.25 Pln |
| delivery time | 2-3 weeks |
|---|
1,4-bis[2-(2-methylphenyl)ethenyl]benzene (CAS 13280-61-0) is a chemical compound with the molecular formula C24H22 and a molecular weight of 310.4 g/mol. IUPAC name: 1,4-bis[2-(2-methylphenyl)ethenyl]benzene. InChIKey: QKLPIYTUUFFRLV-UHFFFAOYSA-N.
| Molecular formula | C24H22 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1,4-bis[2-(2-methylphenyl)ethenyl]benzene |
| InChIKey | QKLPIYTUUFFRLV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C=CC2=CC=C(C=C2)C=CC3=CC=CC=C3C |
Computed by PubChem (NCBI)