cas: 120131-72-8 — see every product listed under this CAS number, including other names
1,4-Bis-boc-1,4,7-triazaheptane 97+% (CAS 120131-72-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A795675-100mg |
| cas | 120131-72-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 8241.31 Pln |
| purity | 97+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A795675 |
Tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate (CAS 120131-72-8) is a chemical compound with the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. IUPAC name: tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate. InChIKey: HGNOQXYYSVIUNS-UHFFFAOYSA-N.
| Molecular formula | C14H29N3O4 |
|---|---|
| Molecular weight | 303.40 g/mol |
| IUPAC name | tert-butyl N-(2-aminoethyl)-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate |
| InChIKey | HGNOQXYYSVIUNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCN(CCN)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)