1,4-Diacetylpiperazine-2,5-dione, 95%
cas: 3027-05-2 — see every product listed under this CAS number, including other names
1,4-Diacetylpiperazine-2,5-dione, 95% (CAS 3027-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A157857-250mg |
| cas | 3027-05-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 375.94 Pln | |
| Ambeed | 100g | 1210.31 Pln | |
| Ambeed | 500g | 5777.12 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 383.22 Pln | |
| Fluorochem | 100g | 1257.91 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 403.22 Pln | |
| BLDpharm | 100g | 1302.90 Pln | |
| BLDpharm | 500g | 6223.39 Pln | |
| Fluorochem | 500g | 5902.11 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1,4-diacetylpiperazine-2,5-dione (CAS 3027-05-2) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: 1,4-diacetylpiperazine-2,5-dione. InChIKey: CBBKKVPJPRZOCM-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 1,4-diacetylpiperazine-2,5-dione |
| InChIKey | CBBKKVPJPRZOCM-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(=O)N(CC1=O)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
1,4-Diacetyl-2,5-piperazinedione, 1,4-diacetylpiperazine-2,5-dione, N,N'-Diacetylglycine Anhydride, 1,4-diacetyltetrahydro-2,5-pyrazinedione, 2,5-Piperazinedione, 1,4-diacetyl-, N,N'-diacetyl-2,5-piperazinedione, 1,4-Diacetyl-2,5-diketopiperazine, 1,4-Diacetyl-2,5-dioxopiperazine, N,N'-Diace, CBBKKVPJPRZOCM-UHFFFAOYSA-