cas: 89634-77-5 — see every product listed under this CAS number, including other names
1,4-Dichloro-2-Fluoro-5-(Trifluoromethyl)Benzene, 97%, 97% (CAS 89634-77-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114W9X-100mg |
| cas | 89634-77-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 842.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,4-dichloro-2-fluoro-5-(trifluoromethyl)benzene (CAS 89634-77-5) is a chemical compound with the molecular formula C7H2Cl2F4 and a molecular weight of 232.99 g/mol. IUPAC name: 1,4-dichloro-2-fluoro-5-(trifluoromethyl)benzene. InChIKey: DXXZFKXKWLVECJ-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F4 |
|---|---|
| Molecular weight | 232.99 g/mol |
| IUPAC name | 1,4-dichloro-2-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | DXXZFKXKWLVECJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)