cas: 170489-16-4 — see every product listed under this CAS number, including other names
1,4-Dimethyl-1H-indole-3-carbaldehyde 95% (CAS 170489-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A438363-100mg |
| cas | 170489-16-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 1076.81 Pln | |
| Ambeed | 10g | 2078.06 Pln | |
| Ambeed | 25g | 5070.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A438363 |
1,4-dimethylindole-3-carbaldehyde (CAS 170489-16-4) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 1,4-dimethylindole-3-carbaldehyde. InChIKey: QGFBNIAKXKURCE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1,4-dimethylindole-3-carbaldehyde |
| InChIKey | QGFBNIAKXKURCE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N(C=C2C=O)C |
Computed by PubChem (NCBI)