cas: 886-66-8 — see every product listed under this CAS number, including other names
1,4-Diphenylbuta-1,3-diyne, 98%, 98% (CAS 886-66-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DP4-1g |
| cas | 886-66-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 1024.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,4-diphenylbutadiyne is a member of benzenes and an arylacetylene. It has a role as a fluorochrome.
Source: ChEBI
| Molecular formula | C16H10 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 4-phenylbuta-1,3-diynylbenzene |
| InChIKey | HMQFJYLWNWIYKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC#CC2=CC=CC=C2 |
Computed by PubChem (NCBI)