cas: 502616-02-6 — see every product listed under this CAS number, including other names
1,4-Dipierazino-2,3,5,6-tetrafluorobenzene, 95%, 95% (CAS 502616-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKLN-100mg |
| cas | 502616-02-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 861.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine (CAS 502616-02-6) is a chemical compound with the molecular formula C14H18F4N4 and a molecular weight of 318.31 g/mol. IUPAC name: 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine. InChIKey: LRTCJFIHCNYPQX-UHFFFAOYSA-N.
| Molecular formula | C14H18F4N4 |
|---|---|
| Molecular weight | 318.31 g/mol |
| IUPAC name | 1-(2,3,5,6-tetrafluoro-4-piperazin-1-ylphenyl)piperazine |
| InChIKey | LRTCJFIHCNYPQX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C(=C(C(=C2F)F)N3CCNCC3)F)F |
Computed by PubChem (NCBI)