1,4-Piperazinedicarboxylic acid, 2-(carboxymethyl)-, 4-(1,1-dimethylethyl) 1-(9H-fluoren-9-ylmethyl) ester, 97%, 97%
cas: 183742-34-9 — see every product listed under this CAS number, including other names
1,4-Piperazinedicarboxylic acid, 2-(carboxymethyl)-, 4-(1,1-dimethylethyl) 1-(9H-fluoren-9-ylmethyl) ester, 97%, 97% (CAS 183742-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118T23-100mg |
| cas | 183742-34-9 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1130.00 Pln | |
| Chemat | 25g | 5142.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid (CAS 183742-34-9) is a chemical compound with the molecular formula C26H30N2O6 and a molecular weight of 466.5 g/mol. IUPAC name: 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid. InChIKey: XHEXEZVLDQGZFP-UHFFFAOYSA-N.
| Molecular formula | C26H30N2O6 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid |
| InChIKey | XHEXEZVLDQGZFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
1-Fmoc-4-Boc-piperazine-2-acetic acid, 4-Boc-1-Fmoc-2-piperazineacetic acid, N-4-Boc-N-1-Fmoc-2-piperazine acetic acid, 4-boc-1-fmoc-2-piperazine acetic acid, 1-Fmoc-4-Boc-2-piperazineacetic Acid, 1-n-fmoc-4-n-boc-piperazine-2-acetic acid, 4-[(9h-fluoren-9-yloxy)carbonyl]-1-(tert-butoxycarbonyl)piperazyl-2-acetic acid, XHEXEZVLDQGZFP-UHFFFAOYSA-N, (r)-n-1-boc-n-4-fmoc-2-piperazine carboxylic acid, 4-Boc-1-Fmoc-2-piperazineaceticacid