1,5-Dibromonaphthalene-2,6-diamine, 97%
cas: 1934749-39-9 — see every product listed under this CAS number, including other names
1,5-Dibromonaphthalene-2,6-diamine, 97% (CAS 1934749-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F981049-100MG |
| cas | 1934749-39-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1075.68 Pln | |
| Fluorochem | 250mg | 1742.11 Pln | |
| Fluorochem | 1g | 4543.21 Pln | |
| Ambeed | 250mg | 1360.50 Pln | |
| Ambeed | 1g | 3674.50 Pln | |
| Ambeed | 5g | 12691.31 Pln | |
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1211.60 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| BLDpharm | 100mg | 841.95 Pln | |
| BLDpharm | 250mg | 1336.22 Pln | |
| BLDpharm | 1g | 3602.09 Pln | |
| BLDpharm | 5g | 12437.87 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1,5-dibromonaphthalene-2,6-diamine (CAS 1934749-39-9) is a chemical compound with the molecular formula C10H8Br2N2 and a molecular weight of 315.99 g/mol. IUPAC name: 1,5-dibromonaphthalene-2,6-diamine. InChIKey: AHMQPFGUYWHXET-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2N2 |
|---|---|
| Molecular weight | 315.99 g/mol |
| IUPAC name | 1,5-dibromonaphthalene-2,6-diamine |
| InChIKey | AHMQPFGUYWHXET-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)N)Br)Br)N |
Computed by PubChem (NCBI)
Synonyms:
1,5-Dibromonaphthalene-2,6-diamine