cas: 155405-81-5 — see every product listed under this CAS number, including other names
1,5-Dimethyl (2S)-2-{[4-(2-{2-amino-4-oxo-1H,7H-pyrrolo[2,3-d]pyrimidin-5-yl}ethyl)phenyl]formamido}pentanedioate, 95%, 95% (CAS 155405-81-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AE53-100mg |
| cas | 155405-81-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1106.00 Pln | |
| Chemat | 1g | 2877.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]pentanedioate (CAS 155405-81-5) is a chemical compound with the molecular formula C22H25N5O6 and a molecular weight of 455.5 g/mol. IUPAC name: dimethyl (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]pentanedioate. InChIKey: WWYZIXUUERDREV-HNNXBMFYSA-N.
| Molecular formula | C22H25N5O6 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | dimethyl (2S)-2-[[4-[2-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]pentanedioate |
| InChIKey | WWYZIXUUERDREV-HNNXBMFYSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)NC(=O)C1=CC=C(C=C1)CCC2=CNC3=C2C(=O)NC(=N3)N |
Computed by PubChem (NCBI)