1,6-Dimethyl-1H-indole-3-carbaldehyde, 98%
cas: 202584-14-3 — see every product listed under this CAS number, including other names
1,6-Dimethyl-1H-indole-3-carbaldehyde, 98% (CAS 202584-14-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A606152-250mg |
| cas | 202584-14-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 851.60 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 869.72 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 804.94 Pln | |
| Fluorochem | 5g | 3715.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1,6-dimethylindole-3-carbaldehyde (CAS 202584-14-3) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 1,6-dimethylindole-3-carbaldehyde. InChIKey: VFOVAOMIZCNUDY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1,6-dimethylindole-3-carbaldehyde |
| InChIKey | VFOVAOMIZCNUDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2C)C=O |
Computed by PubChem (NCBI)