1,6-Diphenylhexa-1,3,5-triene, 95%
cas: 1720-32-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,6-Diphenylhexa-1,3,5-triene, 95% (CAS 1720-32-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 10g. Oferty producentów: AmBeed.
| producent | AmBeed |
|---|---|
| nr katalogowy | A773557-5g |
| cas | 1720-32-7 |
| opakowanie | 5g |
| dostępność | Synthetic Items: 0g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| AmBeed | 5g | 2628,43 Pln | |
| AmBeed | 10g | 4685,59 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene (CAS 1720-32-7) to związek chemiczny o wzorze sumarycznym C18H16 i masie molowej 232.3 g/mol. Nazwa systematyczna IUPAC: [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene. InChIKey: BOBLSBAZCVBABY-WPWUJOAOSA-N.
| Wzór sumaryczny | C18H16 |
|---|---|
| Masa molowa | 232.3 g/mol |
| Nazwa IUPAC | [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| InChIKey | BOBLSBAZCVBABY-WPWUJOAOSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,6-Diphenylhexatriene, DIPHENYLHEXATRIENE, 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene, 1,6 Diphenylhexatriene, 1,6-Diphenylhexa-1,3,5-triene, Dicinnamyl, 1,3,5-Hexatriene, 1,6-diphenyl-, [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene, Diphenylhexatriene, all-trans, (1E,3E,5E)-1,6-Diphenylhexa-1,3,5-triene