Dp-triene, 98%
cas: 1720-32-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Dp-triene, 98% (CAS 1720-32-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A773557-100mg |
| cas | 1720-32-7 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 175,69 Pln | |
| Ambeed | 250mg | 231,31 Pln | |
| Ambeed | 1g | 548,38 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene (CAS 1720-32-7) to związek chemiczny o wzorze sumarycznym C18H16 i masie molowej 232.3 g/mol. Nazwa systematyczna IUPAC: [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene. InChIKey: BOBLSBAZCVBABY-WPWUJOAOSA-N.
| Wzór sumaryczny | C18H16 |
|---|---|
| Masa molowa | 232.3 g/mol |
| Nazwa IUPAC | [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| InChIKey | BOBLSBAZCVBABY-WPWUJOAOSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1,6-Diphenylhexatriene, DIPHENYLHEXATRIENE, 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene, 1,6 Diphenylhexatriene, 1,6-Diphenylhexa-1,3,5-triene, Dicinnamyl, 1,3,5-Hexatriene, 1,6-diphenyl-, [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene, Diphenylhexatriene, all-trans, (1E,3E,5E)-1,6-Diphenylhexa-1,3,5-triene