CAS 1720-32-7 występuje w naszej ofercie pod nazwami: 1,6-Diphenyl-1,3,5-hexatriene, 95%, 1,6-Diphenylhexa-1,3,5-triene, 95%, 1,6-Diphenyl-1,3,5-hexatriene, >95% (HPLC), Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with 2,5-diphenyl-1,2,4-oxadiazole, 1,6–Diphenyl–1,3,5–hexatriene. Oferty producentów: Combi-blocks, AmBeed, TRC, Lumtec, GLPBio. Dostępne opakowania: 25g, 1g, 5g, 10g, 2,5g, On request, 2g, 100mg.
[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene (CAS 1720-32-7) to związek chemiczny o wzorze sumarycznym C18H16 i masie molowej 232.3 g/mol. Nazwa systematyczna IUPAC: [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene. InChIKey: BOBLSBAZCVBABY-WPWUJOAOSA-N.
| Wzór sumaryczny | C18H16 |
|---|---|
| Masa molowa | 232.3 g/mol |
| Nazwa IUPAC | [(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| InChIKey | BOBLSBAZCVBABY-WPWUJOAOSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)