1,8-DIHYDROXY-4,5-DINITROANTHRAQUINONE, 98%
cas: 81-55-0 — see every product listed under this CAS number, including other names
1,8-DIHYDROXY-4,5-DINITROANTHRAQUINONE, 98% (CAS 81-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 15g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F842575-250MG |
| cas | 81-55-0 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 648.75 Pln | |
| Fluorochem | 50g | 1153.78 Pln | |
| Fluorochem | 100g | 2132.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 15g | 323.60 Pln | |
| Chemat | 25g | 395.60 Pln | |
| Chemat | 50g | 693.20 Pln | |
| Chemat | 75g | 1000.40 Pln | |
| Chemat | 100g | 1274.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione (CAS 81-55-0) is a chemical compound with the molecular formula C14H6N2O8 and a molecular weight of 330.21 g/mol. IUPAC name: 1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione. InChIKey: GJCHQJDEYFYWER-UHFFFAOYSA-N.
| Molecular formula | C14H6N2O8 |
|---|---|
| Molecular weight | 330.21 g/mol |
| IUPAC name | 1,8-dihydroxy-4,5-dinitroanthracene-9,10-dione |
| InChIKey | GJCHQJDEYFYWER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1[N+](=O)[O-])C(=O)C3=C(C=CC(=C3C2=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)
Synonyms:
4,5-Dinitrochrysazin, 1,8-Dinitro-4,5-dihydroxyanthraquinone, 1,8-Dihydroxy-4,5-dinitro-9,10-anthracenedione, 1,8-Dihydroxy-4,5-dinitroanthracene-9,10-dione, 9,10-Anthracenedione, 1,8-dihydroxy-4,5-dinitro-, 4,5-Dihydroxy-1,8-dinitroanthraquinone, Anthraquinone, 1,8-dihydroxy-4,5-dinitro-, Chrysazin, 4,5-dinitro-, 1,8-Dihydroxy-4,5-dinitro-9,10-anthraquinone, 0-08-00-00460 (Beilstein Handbook Reference)