CAS 82409-02-7 appears in our catalog under these names: 1,9-Bis-boc-1,5,9-triazanonane, 95%, 1,9-Bis-Boc-1,5,9-triazanonane, 1,9-Bis-boc-1,5,9-triazanonane, 97.0%, Di-tert-butyl (azanediylbis(propane-3,1-diyl))dicarbamate, 97%, 1,9-Bis-boc-1,5,9-triazanonane, 97%. Offered by: Combi-blocks, Iris Biotech, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 25 g, 1 g, 5 g, 10mM/1mL.
Tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]propyl]carbamate (CAS 82409-02-7) is a chemical compound with the molecular formula C16H33N3O4 and a molecular weight of 331.45 g/mol. IUPAC name: tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]propyl]carbamate. InChIKey: RXUZRBQIVIUOLJ-UHFFFAOYSA-N.
| Molecular formula | C16H33N3O4 |
|---|---|
| Molecular weight | 331.45 g/mol |
| IUPAC name | tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]propyl]carbamate |
| InChIKey | RXUZRBQIVIUOLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCNCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)