cas: 15290-77-4 — see every product listed under this CAS number, including other names
1,1,2,2,3,3,4-Heptafluorocyclopentane (CAS 15290-77-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D6U-5g |
| cas | 15290-77-4 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 875.60 Pln |
| delivery time | 3 weeks |
|---|
1,1,2,2,3,3,4-heptafluorocyclopentane (CAS 15290-77-4) is a chemical compound with the molecular formula C5H3F7 and a molecular weight of 196.07 g/mol. IUPAC name: 1,1,2,2,3,3,4-heptafluorocyclopentane. InChIKey: IDBYQQQHBYGLEQ-UHFFFAOYSA-N.
| Molecular formula | C5H3F7 |
|---|---|
| Molecular weight | 196.07 g/mol |
| IUPAC name | 1,1,2,2,3,3,4-heptafluorocyclopentane |
| InChIKey | IDBYQQQHBYGLEQ-UHFFFAOYSA-N |
| SMILES | C1C(C(C(C1(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)