cas: 874298-11-0 — see every product listed under this CAS number, including other names
1，1-diisopropyl-3-(4-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-yl)phenyl)urea, 95%, 95% (CAS 874298-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTQM-250mg |
| cas | 874298-11-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,1-di(propan-2-yl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874298-11-0) is a chemical compound with the molecular formula C19H31BN2O3 and a molecular weight of 346.3 g/mol. IUPAC name: 1,1-di(propan-2-yl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: PZWCVRDJNOELRF-UHFFFAOYSA-N.
| Molecular formula | C19H31BN2O3 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 1,1-di(propan-2-yl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | PZWCVRDJNOELRF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)N(C(C)C)C(C)C |
Computed by PubChem (NCBI)