1-((2,3-Difluoro-4-(trans-4-pentylcyclohexyl)phenyl)ethynyl)-4-ethoxy-2,3-difluorobenzene, 95%
cas: 928208-51-9 — see every product listed under this CAS number, including other names
1-((2,3-Difluoro-4-(trans-4-pentylcyclohexyl)phenyl)ethynyl)-4-ethoxy-2,3-difluorobenzene, 95% (CAS 928208-51-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1502049-1g |
| cas | 928208-51-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 598.44 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 25g | 822.80 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 225.50 Pln | |
| BLDpharm | 25g | 586.48 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-[2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]ethynyl]-4-ethoxy-2,3-difluorobenzene (CAS 928208-51-9) is a chemical compound with the molecular formula C27H30F4O and a molecular weight of 446.5 g/mol. IUPAC name: 1-[2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]ethynyl]-4-ethoxy-2,3-difluorobenzene. InChIKey: HUOASQITFHLADB-UHFFFAOYSA-N.
| Molecular formula | C27H30F4O |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 1-[2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]ethynyl]-4-ethoxy-2,3-difluorobenzene |
| InChIKey | HUOASQITFHLADB-UHFFFAOYSA-N |
| SMILES | CCCCCC1CCC(CC1)C2=C(C(=C(C=C2)C#CC3=C(C(=C(C=C3)OCC)F)F)F)F |
Computed by PubChem (NCBI)