cas: 1509932-05-1 — see every product listed under this CAS number, including other names
1-((3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)pyrrolidine, 98%, 98% (CAS 1509932-05-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXU5-250mg |
| cas | 1509932-05-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1485.20 Pln | |
| Chemat | 100mg | 170.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidine (CAS 1509932-05-1) is a chemical compound with the molecular formula C16H24BNO4S and a molecular weight of 337.2 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidine. InChIKey: KSYYYRXOMWSFOC-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4S |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidine |
| InChIKey | KSYYYRXOMWSFOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N3CCCC3 |
Computed by PubChem (NCBI)