cas: 899721-24-5 — see every product listed under this CAS number, including other names
1-((3-Methyl-2-oxo-2,3-dihydrobenzo[d]oxazol-6-yl)sulfonyl)piperidine-4-carboxylic acid 97% (CAS 899721-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A718689-100mg |
| cas | 899721-24-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A718689 |
1-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidine-4-carboxylic acid (CAS 899721-24-5) is a chemical compound with the molecular formula C14H16N2O6S and a molecular weight of 340.35 g/mol. IUPAC name: 1-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidine-4-carboxylic acid. InChIKey: IQTAOVDKCCVCHH-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O6S |
|---|---|
| Molecular weight | 340.35 g/mol |
| IUPAC name | 1-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidine-4-carboxylic acid |
| InChIKey | IQTAOVDKCCVCHH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N3CCC(CC3)C(=O)O)OC1=O |
Computed by PubChem (NCBI)