cas: 691381-10-9 — see every product listed under this CAS number, including other names
1-((5-Bromo-2-methoxyphenyl)sulfonyl)pyrrolidine 97% (CAS 691381-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279332-250mg |
| cas | 691381-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 225.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A279332 |
1-(5-bromo-2-methoxyphenyl)sulfonylpyrrolidine (CAS 691381-10-9) is a chemical compound with the molecular formula C11H14BrNO3S and a molecular weight of 320.20 g/mol. IUPAC name: 1-(5-bromo-2-methoxyphenyl)sulfonylpyrrolidine. InChIKey: FPKQJHZVAVRUQD-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO3S |
|---|---|
| Molecular weight | 320.20 g/mol |
| IUPAC name | 1-(5-bromo-2-methoxyphenyl)sulfonylpyrrolidine |
| InChIKey | FPKQJHZVAVRUQD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)N2CCCC2 |
Computed by PubChem (NCBI)