cas: 1027511-76-7 — see every product listed under this CAS number, including other names
1-((Benzyloxy)carbonyl)-3-((tert-butoxycarbonyl)amino)pyrrolidine-3-carboxylic acid (CAS 1027511-76-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F600365-100MG |
| cas | 1027511-76-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1091.30 Pln | |
| Fluorochem | 250mg | 2033.68 Pln | |
| Fluorochem | 500mg | 2778.21 Pln | |
| Fluorochem | 1g | 5292.95 Pln |
| delivery time | 3-4 weeks |
|---|
3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1027511-76-7) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: YNGVGDISDWWFCT-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | YNGVGDISDWWFCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)