cas: 864754-17-6 — see every product listed under this CAS number, including other names
1-(1,3-Dioxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97% (CAS 864754-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225287-100MG |
| cas | 864754-17-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 2903.16 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(1,3-dioxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 864754-17-6) is a chemical compound with the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. IUPAC name: 1-(1,3-dioxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: IWEGDQUCWQFKHS-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O4 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | 1-(1,3-dioxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | IWEGDQUCWQFKHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3OCCO3 |
Computed by PubChem (NCBI)