cas: 1052555-88-0 — see every product listed under this CAS number, including other names
1-(1-Isopropylpiperidin-4-yl)-1H-pyrazol-5-amine, 98% (CAS 1052555-88-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1647835-5g |
| cas | 1052555-88-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 91131.88 Pln | |
| Fluorochem | 50mg | 726.85 Pln | |
| Fluorochem | 100mg | 1080.89 Pln | |
| Fluorochem | 250mg | 1762.94 Pln | |
| Fluorochem | 500mg | 2585.57 Pln | |
| Fluorochem | 1g | 3449.84 Pln | |
| Fluorochem | 2.5g | 6537.30 Pln | |
| Fluorochem | 5g | 10431.76 Pln | |
| Chemat | 50mg | 592.40 Pln | |
| Chemat | 100mg | 947.60 Pln | |
| Chemat | 250mg | 1538.00 Pln | |
| Chemat | 500mg | 2157.20 Pln | |
| Chemat | 1g | 2896.40 Pln | |
| Chemat | 5g | 8925.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(1-propan-2-ylpiperidin-4-yl)pyrazol-3-amine (CAS 1052555-88-0) is a chemical compound with the molecular formula C11H20N4 and a molecular weight of 208.30 g/mol. IUPAC name: 2-(1-propan-2-ylpiperidin-4-yl)pyrazol-3-amine. InChIKey: DBLPYRLBAKYMIX-UHFFFAOYSA-N.
| Molecular formula | C11H20N4 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 2-(1-propan-2-ylpiperidin-4-yl)pyrazol-3-amine |
| InChIKey | DBLPYRLBAKYMIX-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)N2C(=CC=N2)N |
Computed by PubChem (NCBI)