cas: 811440-77-4 — see every product listed under this CAS number, including other names
1-(1-Methylethyl)cyclohexyl 2-methyl-2-propenoate, 98%, 98% (CAS 811440-77-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GLJQ-250mg |
| cas | 811440-77-4 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 1826.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate (CAS 811440-77-4) is a chemical compound with the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. IUPAC name: (1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate. InChIKey: KDSLFWBFCGYUIQ-UHFFFAOYSA-N.
| Molecular formula | C13H22O2 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | (1-propan-2-ylcyclohexyl) 2-methylprop-2-enoate |
| InChIKey | KDSLFWBFCGYUIQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1(CCCCC1)OC(=O)C(=C)C |
Computed by PubChem (NCBI)