cas: 126501-70-0 — see every product listed under this CAS number, including other names
1-(2,2,2-Trifluoroacetyl)piperidine-4-carboxylic acid 97% (CAS 126501-70-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209085-250mg |
| cas | 126501-70-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 25g | 3134.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A209085 |
1-(2,2,2-trifluoroacetyl)piperidine-4-carboxylic acid (CAS 126501-70-0) is a chemical compound with the molecular formula C8H10F3NO3 and a molecular weight of 225.16 g/mol. IUPAC name: 1-(2,2,2-trifluoroacetyl)piperidine-4-carboxylic acid. InChIKey: USCGUOIGFONADD-UHFFFAOYSA-N.
| Molecular formula | C8H10F3NO3 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroacetyl)piperidine-4-carboxylic acid |
| InChIKey | USCGUOIGFONADD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)