cas: 1171551-81-7 — see every product listed under this CAS number, including other names
1-(2,2,2-trifluoroethyl)-1,4-diazepane dihydrochloride, 97% (CAS 1171551-81-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A545049-10g |
| cas | 1171551-81-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17282.44 Pln | |
| AmBeed | 5g | 12790.54 Pln | |
| Fluorochem | 100mg | 1304.77 Pln | |
| Fluorochem | 250mg | 1700.46 Pln | |
| Fluorochem | 500mg | 2778.21 Pln | |
| Fluorochem | 1g | 4085.04 Pln | |
| Fluorochem | 5g | 11879.17 Pln | |
| Fluorochem | 10g | 17575.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2,2,2-trifluoroethyl)-1,4-diazepane;dihydrochloride (CAS 1171551-81-7) is a chemical compound with the molecular formula C7H15Cl2F3N2 and a molecular weight of 255.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)-1,4-diazepane;dihydrochloride. InChIKey: XVAAALBCAORXPF-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2F3N2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)-1,4-diazepane;dihydrochloride |
| InChIKey | XVAAALBCAORXPF-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)CC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)