cas: 1217501-20-6 — see every product listed under this CAS number, including other names
1-(2,2-Diethoxyethyl)pyrazole-4-boronic acid, 98%, 98% (CAS 1217501-20-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126SJ-100mg |
| cas | 1217501-20-6 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[1-(2,2-diethoxyethyl)pyrazol-4-yl]boronic acid (CAS 1217501-20-6) is a chemical compound with the molecular formula C9H17BN2O4 and a molecular weight of 228.06 g/mol. IUPAC name: [1-(2,2-diethoxyethyl)pyrazol-4-yl]boronic acid. InChIKey: QXGDFMFEWNRPLV-UHFFFAOYSA-N.
| Molecular formula | C9H17BN2O4 |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | [1-(2,2-diethoxyethyl)pyrazol-4-yl]boronic acid |
| InChIKey | QXGDFMFEWNRPLV-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)CC(OCC)OCC)(O)O |
Computed by PubChem (NCBI)