cas: 2096994-84-0 — see every product listed under this CAS number, including other names
1-(2,4-Dimethylphenyl)-3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea 97% (CAS 2096994-84-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A266484-250mg |
| cas | 2096994-84-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1143.56 Pln | |
| Ambeed | 5g | 4208.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A266484 |
1-(2,4-dimethylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 2096994-84-0) is a chemical compound with the molecular formula C21H27BN2O3 and a molecular weight of 366.3 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: VEXNVWBODUDMBR-UHFFFAOYSA-N.
| Molecular formula | C21H27BN2O3 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | VEXNVWBODUDMBR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NC3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)