cas: 1013-76-9 — see every product listed under this CAS number, including other names
1-(2,4-Dimethylphenyl)piperazine, 98%, 98% (CAS 1013-76-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11157T-1g |
| cas | 1013-76-9 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 376.40 Pln | |
| Chemat | 25g | 827.60 Pln | |
| Chemat | 100g | 2814.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dimethylphenyl)piperazine (CAS 1013-76-9) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)piperazine. InChIKey: RUIMBVCRNZHCRQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)piperazine |
| InChIKey | RUIMBVCRNZHCRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2CCNCC2)C |
Computed by PubChem (NCBI)