cas: 2112731-42-5 — see every product listed under this CAS number, including other names
1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25-heptaoxa-4-azaoctacosan-28-oic acid, 95% (CAS 2112731-42-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD00848449-100mg |
| cas | 2112731-42-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 419.88 Pln | |
| BLDpharm | 250mg | 680.90 Pln | |
| BLDpharm | 1g | 1708.31 Pln | |
| BLDpharm | 5g | 6617.69 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 747.67 Pln | |
| Fluorochem | 1g | 1887.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2112731-42-5) is a chemical compound with the molecular formula C24H40N2O12 and a molecular weight of 548.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LHEVLPWUXYBIOW-UHFFFAOYSA-N.
| Molecular formula | C24H40N2O12 |
|---|---|
| Molecular weight | 548.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LHEVLPWUXYBIOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)