cas: 1414870-52-2 — see every product listed under this CAS number, including other names
1-(2,6-Dibromobenzyl)pyrrolidine (CAS 1414870-52-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632188-1G |
| cas | 1414870-52-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3949.67 Pln | |
| Fluorochem | 5g | 11702.15 Pln |
| delivery time | 3-4 weeks |
|---|
1-[(2,6-dibromophenyl)methyl]pyrrolidine (CAS 1414870-52-2) is a chemical compound with the molecular formula C11H13Br2N and a molecular weight of 319.04 g/mol. IUPAC name: 1-[(2,6-dibromophenyl)methyl]pyrrolidine. InChIKey: OQEGQDBLTFURDR-UHFFFAOYSA-N.
| Molecular formula | C11H13Br2N |
|---|---|
| Molecular weight | 319.04 g/mol |
| IUPAC name | 1-[(2,6-dibromophenyl)methyl]pyrrolidine |
| InChIKey | OQEGQDBLTFURDR-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(C=CC=C2Br)Br |
Computed by PubChem (NCBI)