cas: 64928-55-8 — see every product listed under this CAS number, including other names
1-(2-Aminoethyl)-2,3-dihydro-1H-1,3-benzodiazol-2-one hydrochloride 95% (CAS 64928-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1011405-100mg |
| cas | 64928-55-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 5938.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1011405 |
3-(2-aminoethyl)-1H-benzimidazol-2-one;hydrochloride (CAS 64928-55-8) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-benzimidazol-2-one;hydrochloride. InChIKey: VFQPYJTVVDTJSI-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-benzimidazol-2-one;hydrochloride |
| InChIKey | VFQPYJTVVDTJSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N2CCN.Cl |
Computed by PubChem (NCBI)