CAS 211096-49-0 appears in our catalog under these names: SB-265610/ 97.67% (existing batch purity), SB 265610, SB-265610, SB 265610, 99%, 99%, SB-265610, 99.0%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
1-(2-bromophenyl)-3-(7-cyano-2H-benzotriazol-4-yl)urea (CAS 211096-49-0) is a chemical compound with the molecular formula C14H9BrN6O and a molecular weight of 357.16 g/mol. IUPAC name: 1-(2-bromophenyl)-3-(7-cyano-2H-benzotriazol-4-yl)urea. InChIKey: SEDUMQWZEOMXSO-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN6O |
|---|---|
| Molecular weight | 357.16 g/mol |
| IUPAC name | 1-(2-bromophenyl)-3-(7-cyano-2H-benzotriazol-4-yl)urea |
| InChIKey | SEDUMQWZEOMXSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)NC2=CC=C(C3=NNN=C23)C#N)Br |
Computed by PubChem (NCBI)