CAS 1445866-55-6 appears in our catalog under these names: 1-(2-Bromo-4-chlorophenyl)-4-(trifluoromethyl)-1H-1,2,3-triazole, 98%, 98%, 1-(2-Bromo-4-chlorophenyl)-4-(trifluoromethyl)-1H-1,2,3-triazole, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-(2-bromo-4-chlorophenyl)-4-(trifluoromethyl)triazole (CAS 1445866-55-6) is a chemical compound with the molecular formula C9H4BrClF3N3 and a molecular weight of 326.50 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)-4-(trifluoromethyl)triazole. InChIKey: UPYMLXKJNVYVFS-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClF3N3 |
|---|---|
| Molecular weight | 326.50 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)-4-(trifluoromethyl)triazole |
| InChIKey | UPYMLXKJNVYVFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)N2C=C(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)