cas: 1430751-10-2 — see every product listed under this CAS number, including other names
1-(2-Bromobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95%, 95% (CAS 1430751-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPUI-250mg |
| cas | 1430751-10-2 |
| size | 250mg |
| availability | 8.15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5435.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(2-bromophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1430751-10-2) is a chemical compound with the molecular formula C16H20BBrN2O2 and a molecular weight of 363.1 g/mol. IUPAC name: 1-[(2-bromophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: DSFLJQAALJOSCZ-UHFFFAOYSA-N.
| Molecular formula | C16H20BBrN2O2 |
|---|---|
| Molecular weight | 363.1 g/mol |
| IUPAC name | 1-[(2-bromophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | DSFLJQAALJOSCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CC=CC=C3Br |
Computed by PubChem (NCBI)