1-(2-Chloro-5-fluoropyrimidin-4-yl)-1H-indole-4-carbonitrile, 95%
cas: 3036406-45-5 — see every product listed under this CAS number, including other names
1-(2-Chloro-5-fluoropyrimidin-4-yl)-1H-indole-4-carbonitrile, 95% (CAS 3036406-45-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A2833464-100mg |
| cas | 3036406-45-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1360.50 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1463.95 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(2-chloro-5-fluoropyrimidin-4-yl)indole-4-carbonitrile (CAS 3036406-45-5) is a chemical compound with the molecular formula C13H6ClFN4 and a molecular weight of 272.66 g/mol. IUPAC name: 1-(2-chloro-5-fluoropyrimidin-4-yl)indole-4-carbonitrile. InChIKey: PFQFZRWDBMJJPC-UHFFFAOYSA-N.
| Molecular formula | C13H6ClFN4 |
|---|---|
| Molecular weight | 272.66 g/mol |
| IUPAC name | 1-(2-chloro-5-fluoropyrimidin-4-yl)indole-4-carbonitrile |
| InChIKey | PFQFZRWDBMJJPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CN(C2=C1)C3=NC(=NC=C3F)Cl)C#N |
Computed by PubChem (NCBI)