cas: 1049733-74-5 — see every product listed under this CAS number, including other names
1-(2-Chloro-6-fluoro-benzyl)-[1,4]diazepanedihydrochloride (CAS 1049733-74-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033878-1G |
| cas | 1049733-74-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 2g | 893.45 Pln | |
| Fluorochem | 2.5g | 3533.15 Pln | |
| Fluorochem | 5g | 3892.40 Pln |
| delivery time | 2-3 weeks |
|---|
1-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepane;dihydrochloride (CAS 1049733-74-5) is a chemical compound with the molecular formula C12H18Cl3FN2 and a molecular weight of 315.6 g/mol. IUPAC name: 1-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepane;dihydrochloride. InChIKey: LOJKPRBAIRCXJZ-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl3FN2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 1-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepane;dihydrochloride |
| InChIKey | LOJKPRBAIRCXJZ-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)CC2=C(C=CC=C2Cl)F.Cl.Cl |
Computed by PubChem (NCBI)